C27H50O3Si — CID 132552459
tert-butyl (2E,6S,8E,10E)-2,6-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trienoate (PubChem CID 132552459) has the molecular formula C27H50O3Si and a molecular weight of 450.78 g/mol. Its IUPAC name is tert-butyl (2E,6S,8E,10E)-2,6-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trienoate.
| Compound Name | tert-butyl (2E,6S,8E,10E)-2,6-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trienoate |
|---|---|
| PubChem CID | 132552459 |
| Molecular Formula | C27H50O3Si |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | tert-butyl (2E,6S,8E,10E)-2,6-dimethyl-12-tri(propan-2-yl)silyloxydodeca-2,8,10-trienoate |
| SMILES | C/C(=C\CC[C@H](C)C/C=C/C=C/CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H50O3Si/c1-21(2)31(22(3)4,23(5)6)29-20-15-13-12-14-17-24(7)18-16-19-25(8)26(28)30-27(9,10)11/h12-15,19,21-24H,16-18,20H2,1-11H3/b14-12+,15-13+,25-19+/t24-/m1/s1 |
| InChIKey | PBLFAYWKDAMEHE-SBVINKAJSA-N |
| XLogP | 8.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|