C22H22O6 — CID 132555235
4-[2-[4-[2-(3,5-dihydroxyphenoxy)ethyl]phenoxy]ethyl]benzene-1,2-diol (PubChem CID 132555235) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[2-[4-[2-(3,5-dihydroxyphenoxy)ethyl]phenoxy]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[4-[2-(3,5-dihydroxyphenoxy)ethyl]phenoxy]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 132555235 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[2-[4-[2-(3,5-dihydroxyphenoxy)ethyl]phenoxy]ethyl]benzene-1,2-diol |
| SMILES | Oc1cc(O)cc(OCCc2ccc(OCCc3ccc(O)c(O)c3)cc2)c1 |
| InChI | InChI=1S/C22H22O6/c23-17-12-18(24)14-20(13-17)28-9-7-15-1-4-19(5-2-15)27-10-8-16-3-6-21(25)22(26)11-16/h1-6,11-14,23-26H,7-10H2 |
| InChIKey | WVKMSHOBVYAYPJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|