C19H39N2P — CID 132563504
N-(2-ditert-butylphosphanylcyclopenten-1-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 132563504) has the molecular formula C19H39N2P and a molecular weight of 326.51 g/mol. Its IUPAC name is N-(2-ditert-butylphosphanylcyclopenten-1-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(2-ditert-butylphosphanylcyclopenten-1-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 132563504 |
| Molecular Formula | C19H39N2P |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N-(2-ditert-butylphosphanylcyclopenten-1-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNC1=C(P(C(C)(C)C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C19H39N2P/c1-9-21(10-2)15-14-20-16-12-11-13-17(16)22(18(3,4)5)19(6,7)8/h20H,9-15H2,1-8H3 |
| InChIKey | PQHKTGIKCQBRAV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|