C28H18O4 — CID 132598602
3-(4-methoxyphenyl)spiro[3H-fluorene-4,2'-indene]-1',3',9-trione (PubChem CID 132598602) has the molecular formula C28H18O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)spiro[3H-fluorene-4,2'-indene]-1',3',9-trione.
| Compound Name | 3-(4-methoxyphenyl)spiro[3H-fluorene-4,2'-indene]-1',3',9-trione |
|---|---|
| PubChem CID | 132598602 |
| Molecular Formula | C28H18O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-(4-methoxyphenyl)spiro[3H-fluorene-4,2'-indene]-1',3',9-trione |
| SMILES | COc1ccc(C2C=CC3=C(c4ccccc4C3=O)C23C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H18O4/c1-32-17-12-10-16(11-13-17)23-15-14-22-24(18-6-2-3-7-19(18)25(22)29)28(23)26(30)20-8-4-5-9-21(20)27(28)31/h2-15,23H,1H3 |
| InChIKey | VTHWPHVUAFXWRS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|