C23H15NO3S — CID 132601771
7-(4-methoxyphenyl)chromeno[3,4-c][1,5]benzothiazepin-6-one (PubChem CID 132601771) has the molecular formula C23H15NO3S and a molecular weight of 385.44 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)chromeno[3,4-c][1,5]benzothiazepin-6-one.
| Compound Name | 7-(4-methoxyphenyl)chromeno[3,4-c][1,5]benzothiazepin-6-one |
|---|---|
| PubChem CID | 132601771 |
| Molecular Formula | C23H15NO3S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 7-(4-methoxyphenyl)chromeno[3,4-c][1,5]benzothiazepin-6-one |
| SMILES | COc1ccc(C2=c3c(=O)oc4ccccc4c3=Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C23H15NO3S/c1-26-15-12-10-14(11-13-15)22-20-21(24-17-7-3-5-9-19(17)28-22)16-6-2-4-8-18(16)27-23(20)25/h2-13H,1H3 |
| InChIKey | XTZSHYARRRTMNM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|