C24H23NO4 — CID 132602793
5',5'-dimethyl-2-[(E)-2-(2-nitrophenyl)ethenyl]spiro[1,2-dihydroindene-3,2'-cyclohexane]-1',3'-dione (PubChem CID 132602793) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5',5'-dimethyl-2-[(E)-2-(2-nitrophenyl)ethenyl]spiro[1,2-dihydroindene-3,2'-cyclohexane]-1',3'-dione.
| Compound Name | 5',5'-dimethyl-2-[(E)-2-(2-nitrophenyl)ethenyl]spiro[1,2-dihydroindene-3,2'-cyclohexane]-1',3'-dione |
|---|---|
| PubChem CID | 132602793 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 5',5'-dimethyl-2-[(E)-2-(2-nitrophenyl)ethenyl]spiro[1,2-dihydroindene-3,2'-cyclohexane]-1',3'-dione |
| SMILES | CC1(C)CC(=O)C2(C(=O)C1)c1ccccc1CC2/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23NO4/c1-23(2)14-21(26)24(22(27)15-23)18(13-17-8-3-5-9-19(17)24)12-11-16-7-4-6-10-20(16)25(28)29/h3-12,18H,13-15H2,1-2H3/b12-11+ |
| InChIKey | FTFICIDRDYKTKJ-VAWYXSNFSA-N |
| XLogP | 4.68 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|