C36H27FN2O2P+ — CID 132604500
(2,5-dianilino-4-fluoro-3,6-dioxocyclohexa-1,4-dien-1-yl)-triphenylphosphanium (PubChem CID 132604500) has the molecular formula C36H27FN2O2P+ and a molecular weight of 569.60 g/mol. Its IUPAC name is (2,5-dianilino-4-fluoro-3,6-dioxocyclohexa-1,4-dien-1-yl)-triphenylphosphanium.
| Compound Name | (2,5-dianilino-4-fluoro-3,6-dioxocyclohexa-1,4-dien-1-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 132604500 |
| Molecular Formula | C36H27FN2O2P+ |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | (2,5-dianilino-4-fluoro-3,6-dioxocyclohexa-1,4-dien-1-yl)-triphenylphosphanium |
| SMILES | O=C1C(F)=C(Nc2ccccc2)C(=O)C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)=C1Nc1ccccc1 |
| InChI | InChI=1S/C36H26FN2O2P/c37-31-32(38-26-16-6-1-7-17-26)35(41)36(33(34(31)40)39-27-18-8-2-9-19-27)42(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25H,(H-,38,39,40,41)/p+1 |
| InChIKey | SJJKTEYHNBOFTL-UHFFFAOYSA-O |
| XLogP | 6.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|