C18H16ClNO6 — CID 13285937
(2-methoxy-2-oxoethyl) 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate (PubChem CID 13285937) has the molecular formula C18H16ClNO6 and a molecular weight of 377.78 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 13285937 |
| Molecular Formula | C18H16ClNO6 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate |
| SMILES | COC(=O)COC(=O)c1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C18H16ClNO6/c1-25-15(21)9-26-18(24)13-8-10(6-7-14(13)19)20-16(22)11-4-2-3-5-12(11)17(20)23/h6-8H,2-5,9H2,1H3 |
| InChIKey | QJTPEOPQUYSYFG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|