C10H14N4O2S — CID 132890412
4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 132890412) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | 4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 132890412 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)CC2NCCN(c3ncccn3)C2C1 |
| InChI | InChI=1S/C10H14N4O2S/c15-17(16)6-8-9(7-17)14(5-4-11-8)10-12-2-1-3-13-10/h1-3,8-9,11H,4-7H2 |
| InChIKey | UACPEUUVEGJJKG-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |