C13H8N2S — CID 132915931
16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene (PubChem CID 132915931) has the molecular formula C13H8N2S and a molecular weight of 224.29 g/mol. Its IUPAC name is 16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene.
| Compound Name | 16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 132915931 |
| Molecular Formula | C13H8N2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
| SMILES | c1ccc2c(c1)sc1c2nc2ccccn21 |
| InChI | InChI=1S/C13H8N2S/c1-2-6-10-9(5-1)12-13(16-10)15-8-4-3-7-11(15)14-12/h1-8H |
| InChIKey | JOAWXVIRWDCGOE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |