C17H34O2Si — CID 132916242
(1Z,4S)-6-methyl-1-tri(propan-2-yl)silyloxyhepta-1,5-dien-4-ol (PubChem CID 132916242) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (1Z,4S)-6-methyl-1-tri(propan-2-yl)silyloxyhepta-1,5-dien-4-ol.
| Compound Name | (1Z,4S)-6-methyl-1-tri(propan-2-yl)silyloxyhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 132916242 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (1Z,4S)-6-methyl-1-tri(propan-2-yl)silyloxyhepta-1,5-dien-4-ol |
| SMILES | CC(C)=C[C@@H](O)C/C=C\O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-13(2)12-17(18)10-9-11-19-20(14(3)4,15(5)6)16(7)8/h9,11-12,14-18H,10H2,1-8H3/b11-9-/t17-/m0/s1 |
| InChIKey | FNAABLRLJHRDNV-CCCPALQASA-N |
| XLogP | 5.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|