About CID 132916386
CID 132916386 (PubChem CID 132916386) has the molecular formula C6H7O4
and a molecular weight of 143.12 g/mol.
Molecular Properties
| Compound Name | CID 132916386 |
| PubChem CID | 132916386 |
| Molecular Formula | C6H7O4 |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | — |
| SMILES | COC(=O)OC1C=C[CH]O1 |
| InChI | InChI=1S/C6H7O4/c1-8-6(7)10-5-3-2-4-9-5/h2-5H,1H3 |
| InChIKey | VPTDJSVQGOTIQY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 132916386 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132916386?
The IUPAC name of CID 132916386 (CID 132916386) is not available.
What is the SMILES notation for CID 132916386?
The canonical SMILES for CID 132916386 is COC(=O)OC1C=C[CH]O1.
What is the InChIKey of CID 132916386?
The InChIKey is VPTDJSVQGOTIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O4/c1-8-6(7)10-5-3-2-4-9-5/h2-5H,1H3.
What are the key properties of CID 132916386?
CID 132916386 has a molecular weight of 143.12 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132916386 is sourced from PubChem (CID 132916386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).