C36H49N5O8 — CID 132917509
7-(diethylamino)-3-[1-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)-3-propan-2-yloxyphenyl]triazol-4-yl]chromen-2-one (PubChem CID 132917509) has the molecular formula C36H49N5O8 and a molecular weight of 679.81 g/mol. Its IUPAC name is 7-(diethylamino)-3-[1-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)-3-propan-2-yloxyphenyl]triazol-4-yl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[1-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)-3-propan-2-yloxyphenyl]triazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 132917509 |
| Molecular Formula | C36H49N5O8 |
| Molecular Weight | 679.81 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 7-(diethylamino)-3-[1-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)-3-propan-2-yloxyphenyl]triazol-4-yl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3cn(-c4ccc(N5CCOCCOCCOCCOCCOCC5)c(OC(C)C)c4)nn3)c(=O)oc2c1 |
| InChI | InChI=1S/C36H49N5O8/c1-5-39(6-2)29-8-7-28-23-31(36(42)49-34(28)24-29)32-26-41(38-37-32)30-9-10-33(35(25-30)48-27(3)4)40-11-13-43-15-17-45-19-21-47-22-20-46-18-16-44-14-12-40/h7-10,23-27H,5-6,11-22H2,1-4H3 |
| InChIKey | KJMHXMJMACHVKQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 122.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|