C19H14F2O — CID 132933173
2-(2,2-difluoro-1-phenylethenyl)-6-methoxynaphthalene (PubChem CID 132933173) has the molecular formula C19H14F2O and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(2,2-difluoro-1-phenylethenyl)-6-methoxynaphthalene.
| Compound Name | 2-(2,2-difluoro-1-phenylethenyl)-6-methoxynaphthalene |
|---|---|
| PubChem CID | 132933173 |
| Molecular Formula | C19H14F2O |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(2,2-difluoro-1-phenylethenyl)-6-methoxynaphthalene |
| SMILES | COc1ccc2cc(C(=C(F)F)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C19H14F2O/c1-22-17-10-9-14-11-16(8-7-15(14)12-17)18(19(20)21)13-5-3-2-4-6-13/h2-12H,1H3 |
| InChIKey | AGKIJWAHFPNYPD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |