C18H13FN4O — CID 132967651
6-(1-benzofuran-2-yl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 132967651) has the molecular formula C18H13FN4O and a molecular weight of 320.33 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 6-(1-benzofuran-2-yl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 132967651 |
| Molecular Formula | C18H13FN4O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2)c(F)c(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C18H13FN4O/c19-15-16(14-10-11-6-4-5-9-13(11)24-14)22-18(20)23-17(15)21-12-7-2-1-3-8-12/h1-10H,(H3,20,21,22,23) |
| InChIKey | MWFSWMKSIZHKJR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |