C18H23ClN2O — CID 132969474
(E)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(2-chlorophenyl)but-2-enamide (PubChem CID 132969474) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is (E)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(2-chlorophenyl)but-2-enamide.
| Compound Name | (E)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(2-chlorophenyl)but-2-enamide |
|---|---|
| PubChem CID | 132969474 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (E)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(2-chlorophenyl)but-2-enamide |
| SMILES | C/C(=C\C(=O)NC1CCN2CCCC2C1)c1ccccc1Cl |
| InChI | InChI=1S/C18H23ClN2O/c1-13(16-6-2-3-7-17(16)19)11-18(22)20-14-8-10-21-9-4-5-15(21)12-14/h2-3,6-7,11,14-15H,4-5,8-10,12H2,1H3,(H,20,22)/b13-11+ |
| InChIKey | YDYQGEWZOQCXAA-ACCUITESSA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|