C14H16ClN3O4S2 — CID 132972667
1-[1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]pyrazole-4-carboxylic acid (PubChem CID 132972667) has the molecular formula C14H16ClN3O4S2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 1-[1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 132972667 |
| Molecular Formula | C14H16ClN3O4S2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 1-[1-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC(n3cc(C(=O)O)cn3)C2)sc1Cl |
| InChI | InChI=1S/C14H16ClN3O4S2/c1-9-5-12(23-13(9)15)24(21,22)17-4-2-3-11(8-17)18-7-10(6-16-18)14(19)20/h5-7,11H,2-4,8H2,1H3,(H,19,20) |
| InChIKey | IBIKCHJQQHCSMT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |