C19H18O4 — CID 132988563
5-(3-methylbut-2-enoxy)-8-prop-1-en-2-ylfuro[2,3-h]chromen-2-one (PubChem CID 132988563) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-(3-methylbut-2-enoxy)-8-prop-1-en-2-ylfuro[2,3-h]chromen-2-one.
| Compound Name | 5-(3-methylbut-2-enoxy)-8-prop-1-en-2-ylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 132988563 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-(3-methylbut-2-enoxy)-8-prop-1-en-2-ylfuro[2,3-h]chromen-2-one |
| SMILES | C=C(C)c1cc2c(cc(OCC=C(C)C)c3ccc(=O)oc32)o1 |
| InChI | InChI=1S/C19H18O4/c1-11(2)7-8-21-16-10-17-14(9-15(22-17)12(3)4)19-13(16)5-6-18(20)23-19/h5-7,9-10H,3,8H2,1-2,4H3 |
| InChIKey | SGLHPSWYNWJWRD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|