C14H19N3OS3 — CID 132988816
1-[4-(1,3-benzothiazol-2-yldisulfanyl)piperazin-1-yl]propan-2-ol (PubChem CID 132988816) has the molecular formula C14H19N3OS3 and a molecular weight of 341.53 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yldisulfanyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yldisulfanyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 132988816 |
| Molecular Formula | C14H19N3OS3 |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yldisulfanyl)piperazin-1-yl]propan-2-ol |
| SMILES | CC(O)CN1CCN(SSc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C14H19N3OS3/c1-11(18)10-16-6-8-17(9-7-16)21-20-14-15-12-4-2-3-5-13(12)19-14/h2-5,11,18H,6-10H2,1H3 |
| InChIKey | GGJSHWULCZFVSB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|