About 2-(chloromethyl)acridine
2-(chloromethyl)acridine (PubChem CID 133055095) has the molecular formula C14H10ClN
and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(chloromethyl)acridine.
Molecular Properties
| Compound Name | 2-(chloromethyl)acridine |
| PubChem CID | 133055095 |
| Molecular Formula | C14H10ClN |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-(chloromethyl)acridine |
| SMILES | ClCc1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10ClN/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)16-14/h1-8H,9H2 |
| InChIKey | ZGDKZEZKVWNZDE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)acridine?
The IUPAC name of 2-(chloromethyl)acridine (CID 133055095) is 2-(chloromethyl)acridine.
What is the SMILES notation for 2-(chloromethyl)acridine?
The canonical SMILES for 2-(chloromethyl)acridine is ClCc1ccc2nc3ccccc3cc2c1.
What is the InChIKey of 2-(chloromethyl)acridine?
The InChIKey is ZGDKZEZKVWNZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)16-14/h1-8H,9H2.
What are the key properties of 2-(chloromethyl)acridine?
2-(chloromethyl)acridine has a molecular weight of 227.69 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)acridine is sourced from PubChem (CID 133055095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).