C3H2ClIN2S — CID 133056070
2-(chloromethyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 133056070) has the molecular formula C3H2ClIN2S and a molecular weight of 260.49 g/mol. Its IUPAC name is 2-(chloromethyl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethyl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133056070 |
| Molecular Formula | C3H2ClIN2S |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 259.87 |
| IUPAC Name | 2-(chloromethyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | ClCc1nnc(I)s1 |
| InChI | InChI=1S/C3H2ClIN2S/c4-1-2-6-7-3(5)8-2/h1H2 |
| InChIKey | NPHGTVJMPWGBTM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|