C20H29N5S — CID 133223405
1-[2-(dimethylamino)ethyl]-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223405) has the molecular formula C20H29N5S and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223405 |
| Molecular Formula | C20H29N5S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCn1c(C)cc(C2C(c3ccccn3)NC(=S)N2CCN(C)C)c1C |
| InChI | InChI=1S/C20H29N5S/c1-6-24-14(2)13-16(15(24)3)19-18(17-9-7-8-10-21-17)22-20(26)25(19)12-11-23(4)5/h7-10,13,18-19H,6,11-12H2,1-5H3,(H,22,26) |
| InChIKey | QMHSLANSMXULGU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|