C10H6N6O3 — CID 13329147
(4-nitrophenyl)-(5H-[1,2,4]triazolo[4,3-b][1,2,4]triazol-3-yl)methanone (PubChem CID 13329147) has the molecular formula C10H6N6O3 and a molecular weight of 258.20 g/mol. Its IUPAC name is (4-nitrophenyl)-(5H-[1,2,4]triazolo[4,3-b][1,2,4]triazol-3-yl)methanone.
| Compound Name | (4-nitrophenyl)-(5H-[1,2,4]triazolo[4,3-b][1,2,4]triazol-3-yl)methanone |
|---|---|
| PubChem CID | 13329147 |
| Molecular Formula | C10H6N6O3 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (4-nitrophenyl)-(5H-[1,2,4]triazolo[4,3-b][1,2,4]triazol-3-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1nnc2nc[nH]n12 |
| InChI | InChI=1S/C10H6N6O3/c17-8(6-1-3-7(4-2-6)16(18)19)9-13-14-10-11-5-12-15(9)10/h1-5H,(H,11,12,14) |
| InChIKey | UBXJOMILXCXZNT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|