C15H15N5O — CID 133293354
N-(3,4-dihydro-2H-chromen-4-ylmethyl)-7H-purin-6-amine (PubChem CID 133293354) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-ylmethyl)-7H-purin-6-amine.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 133293354 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-7H-purin-6-amine |
| SMILES | c1ccc2c(c1)OCCC2CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H15N5O/c1-2-4-12-11(3-1)10(5-6-21-12)7-16-14-13-15(18-8-17-13)20-9-19-14/h1-4,8-10H,5-7H2,(H2,16,17,18,19,20) |
| InChIKey | LPZBNEKHLBEVNU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |