C14H12FN5O — CID 129320692
N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-7H-purin-6-amine (PubChem CID 129320692) has the molecular formula C14H12FN5O and a molecular weight of 285.28 g/mol. Its IUPAC name is N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-7H-purin-6-amine.
| Compound Name | N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 129320692 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-7H-purin-6-amine |
| SMILES | Fc1cccc2c1OCC[C@@H]2Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H12FN5O/c15-9-3-1-2-8-10(4-5-21-12(8)9)20-14-11-13(17-6-16-11)18-7-19-14/h1-3,6-7,10H,4-5H2,(H2,16,17,18,19,20)/t10-/m0/s1 |
| InChIKey | ZNXSIJRUOWOACI-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |