C14H12FN5 — CID 166302699
N-[(1S,2R)-2-fluoro-2,3-dihydro-1H-inden-1-yl]-7H-purin-6-amine (PubChem CID 166302699) has the molecular formula C14H12FN5 and a molecular weight of 269.28 g/mol. Its IUPAC name is N-[(1S,2R)-2-fluoro-2,3-dihydro-1H-inden-1-yl]-7H-purin-6-amine.
| Compound Name | N-[(1S,2R)-2-fluoro-2,3-dihydro-1H-inden-1-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 166302699 |
| Molecular Formula | C14H12FN5 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(1S,2R)-2-fluoro-2,3-dihydro-1H-inden-1-yl]-7H-purin-6-amine |
| SMILES | F[C@@H]1Cc2ccccc2[C@@H]1Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H12FN5/c15-10-5-8-3-1-2-4-9(8)11(10)20-14-12-13(17-6-16-12)18-7-19-14/h1-4,6-7,10-11H,5H2,(H2,16,17,18,19,20)/t10-,11+/m1/s1 |
| InChIKey | GIOIVQHZVFWZLL-MNOVXSKESA-N |
| XLogP | 2.40 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |