C15H14FN5 — CID 133446462
N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine (PubChem CID 133446462) has the molecular formula C15H14FN5 and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine.
| Compound Name | N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 133446462 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine |
| SMILES | Fc1ccc2c(c1)C(Nc1ncnc3nc[nH]c13)CCC2 |
| InChI | InChI=1S/C15H14FN5/c16-10-5-4-9-2-1-3-12(11(9)6-10)21-15-13-14(18-7-17-13)19-8-20-15/h4-8,12H,1-3H2,(H2,17,18,19,20,21) |
| InChIKey | HDNFASGEOXITBC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |