C15H15BrClN5 — CID 140980840
N-(3-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine;hydrochloride (PubChem CID 140980840) has the molecular formula C15H15BrClN5 and a molecular weight of 380.68 g/mol. Its IUPAC name is N-(3-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine;hydrochloride.
| Compound Name | N-(3-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 140980840 |
| Molecular Formula | C15H15BrClN5 |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-(3-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7H-purin-6-amine;hydrochloride |
| SMILES | BrC1Cc2ccccc2C(Nc2ncnc3nc[nH]c23)C1.Cl |
| InChI | InChI=1S/C15H14BrN5.ClH/c16-10-5-9-3-1-2-4-11(9)12(6-10)21-15-13-14(18-7-17-13)19-8-20-15;/h1-4,7-8,10,12H,5-6H2,(H2,17,18,19,20,21);1H |
| InChIKey | LDSNISSWCAOZBV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|