C18H16BrN3O2 — CID 133370340
N-[2-[(8-bromoquinolin-2-yl)amino]ethyl]-4-hydroxybenzamide (PubChem CID 133370340) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is N-[2-[(8-bromoquinolin-2-yl)amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[(8-bromoquinolin-2-yl)amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 133370340 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-[2-[(8-bromoquinolin-2-yl)amino]ethyl]-4-hydroxybenzamide |
| SMILES | O=C(NCCNc1ccc2cccc(Br)c2n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H16BrN3O2/c19-15-3-1-2-12-6-9-16(22-17(12)15)20-10-11-21-18(24)13-4-7-14(23)8-5-13/h1-9,23H,10-11H2,(H,20,22)(H,21,24) |
| InChIKey | GHOPSBNXMLZYIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|