C15H14F4N2 — CID 133388060
N-[1-(2,3-dimethylphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133388060) has the molecular formula C15H14F4N2 and a molecular weight of 298.28 g/mol. Its IUPAC name is N-[1-(2,3-dimethylphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[1-(2,3-dimethylphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133388060 |
| Molecular Formula | C15H14F4N2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[1-(2,3-dimethylphenyl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Cc1cccc(C(C)Nc2c(F)c(F)nc(F)c2F)c1C |
| InChI | InChI=1S/C15H14F4N2/c1-7-5-4-6-10(8(7)2)9(3)20-13-11(16)14(18)21-15(19)12(13)17/h4-6,9H,1-3H3,(H,20,21) |
| InChIKey | CEEHSRVMPZMSOL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|