C18H19N3O3S2 — CID 133428386
3-ethyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine (PubChem CID 133428386) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-ethyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133428386 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-ethyl-N-[4-(2-ethylsulfonylphenoxy)phenyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(Nc2ccc(Oc3ccccc3S(=O)(=O)CC)cc2)n1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-3-17-20-18(25-21-17)19-13-9-11-14(12-10-13)24-15-7-5-6-8-16(15)26(22,23)4-2/h5-12H,3-4H2,1-2H3,(H,19,20,21) |
| InChIKey | QJGDIYWOHRUFJS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |