C17H18F3N5 — CID 133434405
N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 133434405) has the molecular formula C17H18F3N5 and a molecular weight of 349.36 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133434405 |
| Molecular Formula | C17H18F3N5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CC(C)CC(Nc1ccc(C(F)(F)F)nn1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H18F3N5/c1-10(2)9-13(16-22-11-5-3-4-6-12(11)23-16)21-15-8-7-14(24-25-15)17(18,19)20/h3-8,10,13H,9H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | CZWBETGIWKKRIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |