C14H11NO — CID 13383476
6-(1H-indol-3-yl)hexa-2,4-diyn-1-ol (PubChem CID 13383476) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-(1H-indol-3-yl)hexa-2,4-diyn-1-ol.
| Compound Name | 6-(1H-indol-3-yl)hexa-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 13383476 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 6-(1H-indol-3-yl)hexa-2,4-diyn-1-ol |
| SMILES | OCC#CC#CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H11NO/c16-10-6-2-1-3-7-12-11-15-14-9-5-4-8-13(12)14/h4-5,8-9,11,15-16H,7,10H2 |
| InChIKey | WCRZQBFFHSVCIY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|