C35H63O11P — CID 13383664
2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19-heptaoxacyclohenicosane (PubChem CID 13383664) has the molecular formula C35H63O11P and a molecular weight of 690.85 g/mol. Its IUPAC name is 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19-heptaoxacyclohenicosane.
| Compound Name | 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19-heptaoxacyclohenicosane |
|---|---|
| PubChem CID | 13383664 |
| Molecular Formula | C35H63O11P |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.41 |
| IUPAC Name | 2-[(4-decyl-2-diethoxyphosphorylphenoxy)methyl]-1,4,7,10,13,16,19-heptaoxacyclohenicosane |
| SMILES | CCCCCCCCCCc1ccc(OCC2COCCOCCOCCOCCOCCOCCO2)c(P(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C35H63O11P/c1-4-7-8-9-10-11-12-13-14-32-15-16-34(35(29-32)47(36,45-5-2)46-6-3)44-31-33-30-42-26-25-40-22-21-38-18-17-37-19-20-39-23-24-41-27-28-43-33/h15-16,29,33H,4-14,17-28,30-31H2,1-3H3 |
| InChIKey | XKRVAMHPXLYRHQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|