C29H51O10P — CID 15151756
[3-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)phenyl]phosphonic acid (PubChem CID 15151756) has the molecular formula C29H51O10P and a molecular weight of 590.69 g/mol. Its IUPAC name is [3-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)phenyl]phosphonic acid.
| Compound Name | [3-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 15151756 |
| Molecular Formula | C29H51O10P |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | [3-decyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-ylmethoxy)phenyl]phosphonic acid |
| SMILES | CCCCCCCCCCc1cccc(P(=O)(O)O)c1OCC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C29H51O10P/c1-2-3-4-5-6-7-8-9-11-26-12-10-13-28(40(30,31)32)29(26)39-25-27-24-37-21-20-35-17-16-33-14-15-34-18-19-36-22-23-38-27/h10,12-13,27H,2-9,11,14-25H2,1H3,(H2,30,31,32) |
| InChIKey | MZFOTCFWXZDZTK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|