C15H19ClN2O8S — CID 13388557
[(2R,3S)-4-amino-2-methylsulfonyloxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl] 2-chloroacetate (PubChem CID 13388557) has the molecular formula C15H19ClN2O8S and a molecular weight of 422.84 g/mol. Its IUPAC name is [(2R,3S)-4-amino-2-methylsulfonyloxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl] 2-chloroacetate.
| Compound Name | [(2R,3S)-4-amino-2-methylsulfonyloxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl] 2-chloroacetate |
|---|---|
| PubChem CID | 13388557 |
| Molecular Formula | C15H19ClN2O8S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | [(2R,3S)-4-amino-2-methylsulfonyloxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl] 2-chloroacetate |
| SMILES | CS(=O)(=O)O[C@@H](COC(=O)CCl)[C@H](NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C15H19ClN2O8S/c1-27(22,23)26-11(9-24-12(19)7-16)13(14(17)20)18-15(21)25-8-10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3,(H2,17,20)(H,18,21)/t11-,13-/m0/s1 |
| InChIKey | DXBBNSGVNPOYDV-AAEUAGOBSA-N |
| XLogP | -0.11 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|