C16H20ClN3O9S — CID 88667655
[(2S)-4-amino-1-[(2-chloroacetyl)carbamoyloxy]-4-oxo-1-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate (PubChem CID 88667655) has the molecular formula C16H20ClN3O9S and a molecular weight of 465.87 g/mol. Its IUPAC name is [(2S)-4-amino-1-[(2-chloroacetyl)carbamoyloxy]-4-oxo-1-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate.
| Compound Name | [(2S)-4-amino-1-[(2-chloroacetyl)carbamoyloxy]-4-oxo-1-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 88667655 |
| Molecular Formula | C16H20ClN3O9S |
| Molecular Weight | 465.87 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [(2S)-4-amino-1-[(2-chloroacetyl)carbamoyloxy]-4-oxo-1-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](CC(N)=O)C(NC(=O)OCc1ccccc1)OC(=O)NC(=O)CCl |
| InChI | InChI=1S/C16H20ClN3O9S/c1-30(25,26)29-11(7-12(18)21)14(28-16(24)19-13(22)8-17)20-15(23)27-9-10-5-3-2-4-6-10/h2-6,11,14H,7-9H2,1H3,(H2,18,21)(H,20,23)(H,19,22,24)/t11-,14?/m0/s1 |
| InChIKey | UQGARIQBYITMJH-ZSOXZCCMSA-N |
| XLogP | -0.05 |
| TPSA | 180.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.87 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|