C16H20ClN3O9S — CID 88724760
[(2S,3S)-1-[acetyl(chloro)carbamoyl]oxy-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate (PubChem CID 88724760) has the molecular formula C16H20ClN3O9S and a molecular weight of 465.87 g/mol. Its IUPAC name is [(2S,3S)-1-[acetyl(chloro)carbamoyl]oxy-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S)-1-[acetyl(chloro)carbamoyl]oxy-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 88724760 |
| Molecular Formula | C16H20ClN3O9S |
| Molecular Weight | 465.87 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [(2S,3S)-1-[acetyl(chloro)carbamoyl]oxy-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate |
| SMILES | CC(=O)N(Cl)C(=O)OC[C@@H](OS(C)(=O)=O)[C@H](NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H20ClN3O9S/c1-10(21)20(17)16(24)28-9-12(29-30(2,25)26)13(14(18)22)19-15(23)27-8-11-6-4-3-5-7-11/h3-7,12-13H,8-9H2,1-2H3,(H2,18,22)(H,19,23)/t12-,13+/m1/s1 |
| InChIKey | MDYRMYBEDJKRBH-OLZOCXBDSA-N |
| XLogP | 0.25 |
| TPSA | 171.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.87 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|