C23H22F2N4O4 — CID 134024214
7-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 134024214) has the molecular formula C23H22F2N4O4 and a molecular weight of 456.45 g/mol. Its IUPAC name is 7-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 134024214 |
| Molecular Formula | C23H22F2N4O4 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 7-[3-[bis(4-fluorophenyl)methoxy]-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C23H22F2N4O4/c1-27-21-19(22(31)28(2)23(27)32)29(13-26-21)11-18(30)12-33-20(14-3-7-16(24)8-4-14)15-5-9-17(25)10-6-15/h3-10,13,18,20,30H,11-12H2,1-2H3 |
| InChIKey | YBZSFDJPUKYSJS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |