C18H23FN4O3 — CID 134060259
N-cyclopropyl-N-[(4-fluorophenyl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 134060259) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is N-cyclopropyl-N-[(4-fluorophenyl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(4-fluorophenyl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 134060259 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-cyclopropyl-N-[(4-fluorophenyl)methyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(C1NNC2CCC([N+](=O)[O-])CC21)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H23FN4O3/c19-12-3-1-11(2-4-12)10-22(13-5-6-13)18(24)17-15-9-14(23(25)26)7-8-16(15)20-21-17/h1-4,13-17,20-21H,5-10H2 |
| InChIKey | WZDPZJAEAZEPHT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|