C16H16N4O3 — CID 134061828
1-(3-oxo-2,4-dihydroquinoxalin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 134061828) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-(3-oxo-2,4-dihydroquinoxalin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-(3-oxo-2,4-dihydroquinoxalin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 134061828 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(3-oxo-2,4-dihydroquinoxalin-1-yl)-2-(1,3,5-trimethylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H16N4O3/c1-9-14(10(2)19(3)18-9)15(22)16(23)20-8-13(21)17-11-6-4-5-7-12(11)20/h4-7H,8H2,1-3H3,(H,17,21) |
| InChIKey | BZTBKLBMPDZOTC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|