C12H13N5O2 — CID 134069476
3-amino-4-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobut-3-ene-1,2-dione (PubChem CID 134069476) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 3-amino-4-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 134069476 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-amino-4-(4-pyrimidin-2-ylpiperazin-1-yl)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(N2CCN(c3ncccn3)CC2)c(=O)c1=O |
| InChI | InChI=1S/C12H13N5O2/c13-8-9(11(19)10(8)18)16-4-6-17(7-5-16)12-14-2-1-3-15-12/h1-3H,4-7,13H2 |
| InChIKey | NAKYKOJMAZOYTC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|