C16H25N3O3S — CID 134074402
N-[(4-propylsulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl)methyl]pyridin-3-amine (PubChem CID 134074402) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(4-propylsulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl)methyl]pyridin-3-amine.
| Compound Name | N-[(4-propylsulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 134074402 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(4-propylsulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl)methyl]pyridin-3-amine |
| SMILES | CCCS(=O)(=O)N1CCOC2C(CNc3cccnc3)CCC21 |
| InChI | InChI=1S/C16H25N3O3S/c1-2-10-23(20,21)19-8-9-22-16-13(5-6-15(16)19)11-18-14-4-3-7-17-12-14/h3-4,7,12-13,15-16,18H,2,5-6,8-11H2,1H3 |
| InChIKey | VVXFYMRHJNKJEJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |