C23H31F6N3O6 — CID 155862783
N-[[4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155862783) has the molecular formula C23H31F6N3O6 and a molecular weight of 559.50 g/mol. Its IUPAC name is N-[[4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155862783 |
| Molecular Formula | C23H31F6N3O6 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[[4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(NCC2CCC3C2OCCN3CC2CCOCC2)c1 |
| InChI | InChI=1S/C19H29N3O2.2C2HF3O2/c1-2-17(13-20-7-1)21-12-16-3-4-18-19(16)24-11-8-22(18)14-15-5-9-23-10-6-15;2*3-2(4,5)1(6)7/h1-2,7,13,15-16,18-19,21H,3-6,8-12,14H2;2*(H,6,7) |
| InChIKey | RARNRGVFSAEPIG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |