C23H24F6N4O6 — CID 155862021
pyridin-3-yl-[7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155862021) has the molecular formula C23H24F6N4O6 and a molecular weight of 566.46 g/mol. Its IUPAC name is pyridin-3-yl-[7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | pyridin-3-yl-[7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155862021 |
| Molecular Formula | C23H24F6N4O6 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | pyridin-3-yl-[7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1cccnc1)N1CCOC2C(CNc3cccnc3)CCC21 |
| InChI | InChI=1S/C19H22N4O2.2C2HF3O2/c24-19(15-3-1-7-20-11-15)23-9-10-25-18-14(5-6-17(18)23)12-22-16-4-2-8-21-13-16;2*3-2(4,5)1(6)7/h1-4,7-8,11,13-14,17-18,22H,5-6,9-10,12H2;2*(H,6,7) |
| InChIKey | JCLVAHRNAWCOQH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |