C20H24F3N5O3 — CID 155842460
N-[[4-(5-methylpyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 155842460) has the molecular formula C20H24F3N5O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is N-[[4-(5-methylpyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-(5-methylpyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842460 |
| Molecular Formula | C20H24F3N5O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[[4-(5-methylpyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cnc(N2CCOC3C(CNc4cccnc4)CCC32)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N5O.C2HF3O2/c1-13-9-21-18(22-10-13)23-7-8-24-17-14(4-5-16(17)23)11-20-15-3-2-6-19-12-15;3-2(4,5)1(6)7/h2-3,6,9-10,12,14,16-17,20H,4-5,7-8,11H2,1H3;(H,6,7) |
| InChIKey | VQBAXTKBJJSLAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |