C18H20F3N5O4S — CID 155844290
[7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155844290) has the molecular formula C18H20F3N5O4S and a molecular weight of 459.45 g/mol. Its IUPAC name is [7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844290 |
| Molecular Formula | C18H20F3N5O4S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1csnn1)N1CCOC2C(CNc3cccnc3)CCC21 |
| InChI | InChI=1S/C16H19N5O2S.C2HF3O2/c22-16(13-10-24-20-19-13)21-6-7-23-15-11(3-4-14(15)21)8-18-12-2-1-5-17-9-12;3-2(4,5)1(6)7/h1-2,5,9-11,14-15,18H,3-4,6-8H2;(H,6,7) |
| InChIKey | OPRCJLIUPJHNGU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |