C15H18N6O2S — CID 97403585
[(4aS,7R,7aR)-7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone (PubChem CID 97403585) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(4aS,7R,7aR)-7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97403585 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(4aS,7R,7aR)-7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)N1CCO[C@@H]2[C@@H](CNc3ncccn3)CC[C@@H]21 |
| InChI | InChI=1S/C15H18N6O2S/c22-14(11-9-24-20-19-11)21-6-7-23-13-10(2-3-12(13)21)8-18-15-16-4-1-5-17-15/h1,4-5,9-10,12-13H,2-3,6-8H2,(H,16,17,18)/t10-,12+,13-/m1/s1 |
| InChIKey | GYZTVIGSSNKNFL-KGYLQXTDSA-N |
| XLogP | 1.06 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |