C16H19N5O2S — CID 97403613
[(4aS,7R,7aR)-7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone (PubChem CID 97403613) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(4aS,7R,7aR)-7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97403613 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [(4aS,7R,7aR)-7-[(pyridin-3-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)N1CCO[C@@H]2[C@@H](CNc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C16H19N5O2S/c22-16(13-10-24-20-19-13)21-6-7-23-15-11(3-4-14(15)21)8-18-12-2-1-5-17-9-12/h1-2,5,9-11,14-15,18H,3-4,6-8H2/t11-,14+,15-/m1/s1 |
| InChIKey | WHFIKGWGAVNSFD-BYCMXARLSA-N |
| XLogP | 1.66 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |