C13H11F2N3O2 — CID 134098006
5-(difluoromethyl)-4-methyl-2-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-one (PubChem CID 134098006) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is 5-(difluoromethyl)-4-methyl-2-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(difluoromethyl)-4-methyl-2-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 134098006 |
| Molecular Formula | C13H11F2N3O2 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(difluoromethyl)-4-methyl-2-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-one |
| SMILES | Cn1c(C(F)F)nn(C(=O)/C=C/c2ccccc2)c1=O |
| InChI | InChI=1S/C13H11F2N3O2/c1-17-12(11(14)15)16-18(13(17)20)10(19)8-7-9-5-3-2-4-6-9/h2-8,11H,1H3/b8-7+ |
| InChIKey | PEVWCKHBCUVLRQ-BQYQJAHWSA-N |
| XLogP | 1.87 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|